前端代码

2025-05-12 16:42:36 +09:00
commit 7c63f2f07b
4531 changed files with 656010 additions and 0 deletions
--- a/node_modules/send/HISTORY.md
+++ b/node_modules/send/HISTORY.md
@ -0,0 +1,462 @@
+0.16.2 / 2018-02-07
+===================
+
+  * Fix incorrect end tag in default error & redirects
+  * deps: depd@~1.1.2
+    - perf: remove argument reassignment
+  * deps: encodeurl@~1.0.2
+    - Fix encoding `%` as last character
+  * deps: statuses@~1.4.0
+
+0.16.1 / 2017-09-29
+===================
+
+  * Fix regression in edge-case behavior for empty `path`
+
+0.16.0 / 2017-09-27
+===================
+
+  * Add `immutable` option
+  * Fix missing `</html>` in default error & redirects
+  * Use instance methods on steam to check for listeners
+  * deps: mime@1.4.1
+    - Add 70 new types for file extensions
+    - Set charset as "UTF-8" for .js and .json
+  * perf: improve path validation speed
+
+0.15.6 / 2017-09-22
+===================
+
+  * deps: debug@2.6.9
+  * perf: improve `If-Match` token parsing
+
+0.15.5 / 2017-09-20
+===================
+
+  * deps: etag@~1.8.1
+    - perf: replace regular expression with substring
+  * deps: fresh@0.5.2
+    - Fix handling of modified headers with invalid dates
+    - perf: improve ETag match loop
+    - perf: improve `If-None-Match` token parsing
+
+0.15.4 / 2017-08-05
+===================
+
+  * deps: debug@2.6.8
+  * deps: depd@~1.1.1
+    - Remove unnecessary `Buffer` loading
+  * deps: http-errors@~1.6.2
+    - deps: depd@1.1.1
+
+0.15.3 / 2017-05-16
+===================
+
+  * deps: debug@2.6.7
+    - deps: ms@2.0.0
+  * deps: ms@2.0.0
+
+0.15.2 / 2017-04-26
+===================
+
+  * deps: debug@2.6.4
+    - Fix `DEBUG_MAX_ARRAY_LENGTH`
+    - deps: ms@0.7.3
+  * deps: ms@1.0.0
+
+0.15.1 / 2017-03-04
+===================
+
+  * Fix issue when `Date.parse` does not return `NaN` on invalid date
+  * Fix strict violation in broken environments
+
+0.15.0 / 2017-02-25
+===================
+
+  * Support `If-Match` and `If-Unmodified-Since` headers
+  * Add `res` and `path` arguments to `directory` event
+  * Remove usage of `res._headers` private field
+    - Improves compatibility with Node.js 8 nightly
+  * Send complete HTML document in redirect & error responses
+  * Set default CSP header in redirect & error responses
+  * Use `res.getHeaderNames()` when available
+  * Use `res.headersSent` when available
+  * deps: debug@2.6.1
+    - Allow colors in workers
+    - Deprecated `DEBUG_FD` environment variable set to `3` or higher
+    - Fix error when running under React Native
+    - Use same color for same namespace
+    - deps: ms@0.7.2
+  * deps: etag@~1.8.0
+  * deps: fresh@0.5.0
+    - Fix false detection of `no-cache` request directive
+    - Fix incorrect result when `If-None-Match` has both `*` and ETags
+    - Fix weak `ETag` matching to match spec
+    - perf: delay reading header values until needed
+    - perf: enable strict mode
+    - perf: hoist regular expressions
+    - perf: remove duplicate conditional
+    - perf: remove unnecessary boolean coercions
+    - perf: skip checking modified time if ETag check failed
+    - perf: skip parsing `If-None-Match` when no `ETag` header
+    - perf: use `Date.parse` instead of `new Date`
+  * deps: http-errors@~1.6.1
+    - Make `message` property enumerable for `HttpError`s
+    - deps: setprototypeof@1.0.3
+
+0.14.2 / 2017-01-23
+===================
+
+  * deps: http-errors@~1.5.1
+    - deps: inherits@2.0.3
+    - deps: setprototypeof@1.0.2
+    - deps: statuses@'>= 1.3.1 < 2'
+  * deps: ms@0.7.2
+  * deps: statuses@~1.3.1
+
+0.14.1 / 2016-06-09
+===================
+
+  * Fix redirect error when `path` contains raw non-URL characters
+  * Fix redirect when `path` starts with multiple forward slashes
+
+0.14.0 / 2016-06-06
+===================
+
+  * Add `acceptRanges` option
+  * Add `cacheControl` option
+  * Attempt to combine multiple ranges into single range
+  * Correctly inherit from `Stream` class
+  * Fix `Content-Range` header in 416 responses when using `start`/`end` options
+  * Fix `Content-Range` header missing from default 416 responses
+  * Ignore non-byte `Range` headers
+  * deps: http-errors@~1.5.0
+    - Add `HttpError` export, for `err instanceof createError.HttpError`
+    - Support new code `421 Misdirected Request`
+    - Use `setprototypeof` module to replace `__proto__` setting
+    - deps: inherits@2.0.1
+    - deps: statuses@'>= 1.3.0 < 2'
+    - perf: enable strict mode
+  * deps: range-parser@~1.2.0
+    - Fix incorrectly returning -1 when there is at least one valid range
+    - perf: remove internal function
+  * deps: statuses@~1.3.0
+    - Add `421 Misdirected Request`
+    - perf: enable strict mode
+  * perf: remove argument reassignment
+
+0.13.2 / 2016-03-05
+===================
+
+  * Fix invalid `Content-Type` header when `send.mime.default_type` unset
+
+0.13.1 / 2016-01-16
+===================
+
+  * deps: depd@~1.1.0
+    - Support web browser loading
+    - perf: enable strict mode
+  * deps: destroy@~1.0.4
+    - perf: enable strict mode
+  * deps: escape-html@~1.0.3
+    - perf: enable strict mode
+    - perf: optimize string replacement
+    - perf: use faster string coercion
+  * deps: range-parser@~1.0.3
+    - perf: enable strict mode
+
+0.13.0 / 2015-06-16
+===================
+
+  * Allow Node.js HTTP server to set `Date` response header
+  * Fix incorrectly removing `Content-Location` on 304 response
+  * Improve the default redirect response headers
+  * Send appropriate headers on default error response
+  * Use `http-errors` for standard emitted errors
+  * Use `statuses` instead of `http` module for status messages
+  * deps: escape-html@1.0.2
+  * deps: etag@~1.7.0
+    - Improve stat performance by removing hashing
+  * deps: fresh@0.3.0
+    - Add weak `ETag` matching support
+  * deps: on-finished@~2.3.0
+    - Add defined behavior for HTTP `CONNECT` requests
+    - Add defined behavior for HTTP `Upgrade` requests
+    - deps: ee-first@1.1.1
+  * perf: enable strict mode
+  * perf: remove unnecessary array allocations
+
+0.12.3 / 2015-05-13
+===================
+
+  * deps: debug@~2.2.0
+    - deps: ms@0.7.1
+  * deps: depd@~1.0.1
+  * deps: etag@~1.6.0
+   - Improve support for JXcore
+   - Support "fake" stats objects in environments without `fs`
+  * deps: ms@0.7.1
+    - Prevent extraordinarily long inputs
+  * deps: on-finished@~2.2.1
+
+0.12.2 / 2015-03-13
+===================
+
+  * Throw errors early for invalid `extensions` or `index` options
+  * deps: debug@~2.1.3
+    - Fix high intensity foreground color for bold
+    - deps: ms@0.7.0
+
+0.12.1 / 2015-02-17
+===================
+
+  * Fix regression sending zero-length files
+
+0.12.0 / 2015-02-16
+===================
+
+  * Always read the stat size from the file
+  * Fix mutating passed-in `options`
+  * deps: mime@1.3.4
+
+0.11.1 / 2015-01-20
+===================
+
+  * Fix `root` path disclosure
+
+0.11.0 / 2015-01-05
+===================
+
+  * deps: debug@~2.1.1
+  * deps: etag@~1.5.1
+    - deps: crc@3.2.1
+  * deps: ms@0.7.0
+    - Add `milliseconds`
+    - Add `msecs`
+    - Add `secs`
+    - Add `mins`
+    - Add `hrs`
+    - Add `yrs`
+  * deps: on-finished@~2.2.0
+
+0.10.1 / 2014-10-22
+===================
+
+  * deps: on-finished@~2.1.1
+    - Fix handling of pipelined requests
+
+0.10.0 / 2014-10-15
+===================
+
+  * deps: debug@~2.1.0
+    - Implement `DEBUG_FD` env variable support
+  * deps: depd@~1.0.0
+  * deps: etag@~1.5.0
+    - Improve string performance
+    - Slightly improve speed for weak ETags over 1KB
+
+0.9.3 / 2014-09-24
+==================
+
+  * deps: etag@~1.4.0
+    - Support "fake" stats objects
+
+0.9.2 / 2014-09-15
+==================
+
+  * deps: depd@0.4.5
+  * deps: etag@~1.3.1
+  * deps: range-parser@~1.0.2
+
+0.9.1 / 2014-09-07
+==================
+
+  * deps: fresh@0.2.4
+
+0.9.0 / 2014-09-07
+==================
+
+  * Add `lastModified` option
+  * Use `etag` to generate `ETag` header
+  * deps: debug@~2.0.0
+
+0.8.5 / 2014-09-04
+==================
+
+  * Fix malicious path detection for empty string path
+
+0.8.4 / 2014-09-04
+==================
+
+  * Fix a path traversal issue when using `root`
+
+0.8.3 / 2014-08-16
+==================
+
+  * deps: destroy@1.0.3
+    - renamed from dethroy
+  * deps: on-finished@2.1.0
+
+0.8.2 / 2014-08-14
+==================
+
+  * Work around `fd` leak in Node.js 0.10 for `fs.ReadStream`
+  * deps: dethroy@1.0.2
+
+0.8.1 / 2014-08-05
+==================
+
+  * Fix `extensions` behavior when file already has extension
+
+0.8.0 / 2014-08-05
+==================
+
+  * Add `extensions` option
+
+0.7.4 / 2014-08-04
+==================
+
+  * Fix serving index files without root dir
+
+0.7.3 / 2014-07-29
+==================
+
+  * Fix incorrect 403 on Windows and Node.js 0.11
+
+0.7.2 / 2014-07-27
+==================
+
+  * deps: depd@0.4.4
+    - Work-around v8 generating empty stack traces
+
+0.7.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+   - Fix exception when global `Error.stackTraceLimit` is too low
+
+0.7.0 / 2014-07-20
+==================
+
+ * Deprecate `hidden` option; use `dotfiles` option
+ * Add `dotfiles` option
+ * deps: debug@1.0.4
+ * deps: depd@0.4.2
+   - Add `TRACE_DEPRECATION` environment variable
+   - Remove non-standard grey color from color output
+   - Support `--no-deprecation` argument
+   - Support `--trace-deprecation` argument
+
+0.6.0 / 2014-07-11
+==================
+
+ * Deprecate `from` option; use `root` option
+ * Deprecate `send.etag()` -- use `etag` in `options`
+ * Deprecate `send.hidden()` -- use `hidden` in `options`
+ * Deprecate `send.index()` -- use `index` in `options`
+ * Deprecate `send.maxage()` -- use `maxAge` in `options`
+ * Deprecate `send.root()` -- use `root` in `options`
+ * Cap `maxAge` value to 1 year
+ * deps: debug@1.0.3
+   - Add support for multiple wildcards in namespaces
+
+0.5.0 / 2014-06-28
+==================
+
+ * Accept string for `maxAge` (converted by `ms`)
+ * Add `headers` event
+ * Include link in default redirect response
+ * Use `EventEmitter.listenerCount` to count listeners
+
+0.4.3 / 2014-06-11
+==================
+
+ * Do not throw un-catchable error on file open race condition
+ * Use `escape-html` for HTML escaping
+ * deps: debug@1.0.2
+   - fix some debugging output colors on node.js 0.8
+ * deps: finished@1.2.2
+ * deps: fresh@0.2.2
+
+0.4.2 / 2014-06-09
+==================
+
+ * fix "event emitter leak" warnings
+ * deps: debug@1.0.1
+ * deps: finished@1.2.1
+
+0.4.1 / 2014-06-02
+==================
+
+ * Send `max-age` in `Cache-Control` in correct format
+
+0.4.0 / 2014-05-27
+==================
+
+ * Calculate ETag with md5 for reduced collisions
+ * Fix wrong behavior when index file matches directory
+ * Ignore stream errors after request ends
+   - Goodbye `EBADF, read`
+ * Skip directories in index file search
+ * deps: debug@0.8.1
+
+0.3.0 / 2014-04-24
+==================
+
+ * Fix sending files with dots without root set
+ * Coerce option types
+ * Accept API options in options object
+ * Set etags to "weak"
+ * Include file path in etag
+ * Make "Can't set headers after they are sent." catchable
+ * Send full entity-body for multi range requests
+ * Default directory access to 403 when index disabled
+ * Support multiple index paths
+ * Support "If-Range" header
+ * Control whether to generate etags
+ * deps: mime@1.2.11
+
+0.2.0 / 2014-01-29
+==================
+
+ * update range-parser and fresh
+
+0.1.4 / 2013-08-11 
+==================
+
+ * update fresh
+
+0.1.3 / 2013-07-08 
+==================
+
+ * Revert "Fix fd leak"
+
+0.1.2 / 2013-07-03 
+==================
+
+ * Fix fd leak
+
+0.1.0 / 2012-08-25 
+==================
+
+  * add options parameter to send() that is passed to fs.createReadStream() [kanongil]
+
+0.0.4 / 2012-08-16 
+==================
+
+  * allow custom "Accept-Ranges" definition
+
+0.0.3 / 2012-07-16 
+==================
+
+  * fix normalization of the root directory. Closes #3
+
+0.0.2 / 2012-07-09 
+==================
+
+  * add passing of req explicitly for now (YUCK)
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release
--- a/node_modules/send/LICENSE
+++ b/node_modules/send/LICENSE
@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012 TJ Holowaychuk
+Copyright (c) 2014-2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
--- a/node_modules/send/README.md
+++ b/node_modules/send/README.md
@ -0,0 +1,306 @@
+# send
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Linux Build][travis-image]][travis-url]
+[![Windows Build][appveyor-image]][appveyor-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Send is a library for streaming files from the file system as a http response
+supporting partial responses (Ranges), conditional-GET negotiation (If-Match,
+If-Unmodified-Since, If-None-Match, If-Modified-Since), high test coverage,
+and granular events which may be leveraged to take appropriate actions in your
+application or framework.
+
+Looking to serve up entire folders mapped to URLs? Try [serve-static](https://www.npmjs.org/package/serve-static).
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```bash
+$ npm install send
+```
+
+## API
+
+<!-- eslint-disable no-unused-vars -->
+
+```js
+var send = require('send')
+```
+
+### send(req, path, [options])
+
+Create a new `SendStream` for the given path to send to a `res`. The `req` is
+the Node.js HTTP request and the `path` is a urlencoded path to send (urlencoded,
+not the actual file-system path).
+
+#### Options
+
+##### acceptRanges
+
+Enable or disable accepting ranged requests, defaults to true.
+Disabling this will not send `Accept-Ranges` and ignore the contents
+of the `Range` request header.
+
+##### cacheControl
+
+Enable or disable setting `Cache-Control` response header, defaults to
+true. Disabling this will ignore the `immutable` and `maxAge` options.
+
+##### dotfiles
+
+Set how "dotfiles" are treated when encountered. A dotfile is a file
+or directory that begins with a dot ("."). Note this check is done on
+the path itself without checking if the path actually exists on the
+disk. If `root` is specified, only the dotfiles above the root are
+checked (i.e. the root itself can be within a dotfile when when set
+to "deny").
+
+  - `'allow'` No special treatment for dotfiles.
+  - `'deny'` Send a 403 for any request for a dotfile.
+  - `'ignore'` Pretend like the dotfile does not exist and 404.
+
+The default value is _similar_ to `'ignore'`, with the exception that
+this default will not ignore the files within a directory that begins
+with a dot, for backward-compatibility.
+
+##### end
+
+Byte offset at which the stream ends, defaults to the length of the file
+minus 1. The end is inclusive in the stream, meaning `end: 3` will include
+the 4th byte in the stream.
+
+##### etag
+
+Enable or disable etag generation, defaults to true.
+
+##### extensions
+
+If a given file doesn't exist, try appending one of the given extensions,
+in the given order. By default, this is disabled (set to `false`). An
+example value that will serve extension-less HTML files: `['html', 'htm']`.
+This is skipped if the requested file already has an extension.
+
+##### immutable
+
+Enable or diable the `immutable` directive in the `Cache-Control` response
+header, defaults to `false`. If set to `true`, the `maxAge` option should
+also be specified to enable caching. The `immutable` directive will prevent
+supported clients from making conditional requests during the life of the
+`maxAge` option to check if the file has changed.
+
+##### index
+
+By default send supports "index.html" files, to disable this
+set `false` or to supply a new index pass a string or an array
+in preferred order.
+
+##### lastModified
+
+Enable or disable `Last-Modified` header, defaults to true. Uses the file
+system's last modified value.
+
+##### maxAge
+
+Provide a max-age in milliseconds for http caching, defaults to 0.
+This can also be a string accepted by the
+[ms](https://www.npmjs.org/package/ms#readme) module.
+
+##### root
+
+Serve files relative to `path`.
+
+##### start
+
+Byte offset at which the stream starts, defaults to 0. The start is inclusive,
+meaning `start: 2` will include the 3rd byte in the stream.
+
+#### Events
+
+The `SendStream` is an event emitter and will emit the following events:
+
+  - `error` an error occurred `(err)`
+  - `directory` a directory was requested `(res, path)`
+  - `file` a file was requested `(path, stat)`
+  - `headers` the headers are about to be set on a file `(res, path, stat)`
+  - `stream` file streaming has started `(stream)`
+  - `end` streaming has completed
+
+#### .pipe
+
+The `pipe` method is used to pipe the response into the Node.js HTTP response
+object, typically `send(req, path, options).pipe(res)`.
+
+### .mime
+
+The `mime` export is the global instance of of the
+[`mime` npm module](https://www.npmjs.com/package/mime).
+
+This is used to configure the MIME types that are associated with file extensions
+as well as other options for how to resolve the MIME type of a file (like the
+default type to use for an unknown file extension).
+
+## Error-handling
+
+By default when no `error` listeners are present an automatic response will be
+made, otherwise you have full control over the response, aka you may show a 5xx
+page etc.
+
+## Caching
+
+It does _not_ perform internal caching, you should use a reverse proxy cache
+such as Varnish for this, or those fancy things called CDNs. If your
+application is small enough that it would benefit from single-node memory
+caching, it's small enough that it does not need caching at all ;).
+
+## Debugging
+
+To enable `debug()` instrumentation output export __DEBUG__:
+
+```
+$ DEBUG=send node app
+```
+
+## Running tests
+
+```
+$ npm install
+$ npm test
+```
+
+## Examples
+
+### Small example
+
+```js
+var http = require('http')
+var parseUrl = require('parseurl')
+var send = require('send')
+
+var server = http.createServer(function onRequest (req, res) {
+  send(req, parseUrl(req).pathname).pipe(res)
+})
+
+server.listen(3000)
+```
+
+### Custom file types
+
+```js
+var http = require('http')
+var parseUrl = require('parseurl')
+var send = require('send')
+
+// Default unknown types to text/plain
+send.mime.default_type = 'text/plain'
+
+// Add a custom type
+send.mime.define({
+  'application/x-my-type': ['x-mt', 'x-mtt']
+})
+
+var server = http.createServer(function onRequest (req, res) {
+  send(req, parseUrl(req).pathname).pipe(res)
+})
+
+server.listen(3000)
+```
+
+### Custom directory index view
+
+This is a example of serving up a structure of directories with a
+custom function to render a listing of a directory.
+
+```js
+var http = require('http')
+var fs = require('fs')
+var parseUrl = require('parseurl')
+var send = require('send')
+
+// Transfer arbitrary files from within /www/example.com/public/*
+// with a custom handler for directory listing
+var server = http.createServer(function onRequest (req, res) {
+  send(req, parseUrl(req).pathname, {index: false, root: '/www/example.com/public'})
+  .once('directory', directory)
+  .pipe(res)
+})
+
+server.listen(3000)
+
+// Custom directory handler
+function directory (res, path) {
+  var stream = this
+
+  // redirect to trailing slash for consistent url
+  if (!stream.hasTrailingSlash()) {
+    return stream.redirect(path)
+  }
+
+  // get directory list
+  fs.readdir(path, function onReaddir (err, list) {
+    if (err) return stream.error(err)
+
+    // render an index for the directory
+    res.setHeader('Content-Type', 'text/plain; charset=UTF-8')
+    res.end(list.join('\n') + '\n')
+  })
+}
+```
+
+### Serving from a root directory with custom error-handling
+
+```js
+var http = require('http')
+var parseUrl = require('parseurl')
+var send = require('send')
+
+var server = http.createServer(function onRequest (req, res) {
+  // your custom error-handling logic:
+  function error (err) {
+    res.statusCode = err.status || 500
+    res.end(err.message)
+  }
+
+  // your custom headers
+  function headers (res, path, stat) {
+    // serve all files for download
+    res.setHeader('Content-Disposition', 'attachment')
+  }
+
+  // your custom directory handling logic:
+  function redirect () {
+    res.statusCode = 301
+    res.setHeader('Location', req.url + '/')
+    res.end('Redirecting to ' + req.url + '/')
+  }
+
+  // transfer arbitrary files from within
+  // /www/example.com/public/*
+  send(req, parseUrl(req).pathname, {root: '/www/example.com/public'})
+  .on('error', error)
+  .on('directory', redirect)
+  .on('headers', headers)
+  .pipe(res)
+})
+
+server.listen(3000)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/send.svg
+[npm-url]: https://npmjs.org/package/send
+[travis-image]: https://img.shields.io/travis/pillarjs/send/master.svg?label=linux
+[travis-url]: https://travis-ci.org/pillarjs/send
+[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/send/master.svg?label=windows
+[appveyor-url]: https://ci.appveyor.com/project/dougwilson/send
+[coveralls-image]: https://img.shields.io/coveralls/pillarjs/send/master.svg
+[coveralls-url]: https://coveralls.io/r/pillarjs/send?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/send.svg
+[downloads-url]: https://npmjs.org/package/send
--- a/node_modules/send/index.js
+++ b/node_modules/send/index.js
--- a/node_modules/send/node_modules/.bin/mime
+++ b/node_modules/send/node_modules/.bin/mime
@ -0,0 +1,15 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+    *CYGWIN*) basedir=`cygpath -w "$basedir"`;;
+esac
+
+if [ -x "$basedir/node" ]; then
+  "$basedir/node"  "$basedir/../../../mime/cli.js" "$@"
+  ret=$?
+else 
+  node  "$basedir/../../../mime/cli.js" "$@"
+  ret=$?
+fi
+exit $ret
--- a/node_modules/send/node_modules/.bin/mime.cmd
+++ b/node_modules/send/node_modules/.bin/mime.cmd
@ -0,0 +1,7 @@
+@IF EXIST "%~dp0\node.exe" (
+  "%~dp0\node.exe"  "%~dp0\..\..\..\mime\cli.js" %*
+) ELSE (
+  @SETLOCAL
+  @SET PATHEXT=%PATHEXT:;.JS;=;%
+  node  "%~dp0\..\..\..\mime\cli.js" %*
+)
--- a/node_modules/send/node_modules/debug/.coveralls.yml
+++ b/node_modules/send/node_modules/debug/.coveralls.yml
@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve
--- a/node_modules/send/node_modules/debug/.eslintrc
+++ b/node_modules/send/node_modules/debug/.eslintrc
@ -0,0 +1,11 @@
+{
+  "env": {
+    "browser": true,
+    "node": true
+  },
+  "rules": {
+    "no-console": 0,
+    "no-empty": [1, { "allowEmptyCatch": true }]
+  },
+  "extends": "eslint:recommended"
+}
--- a/node_modules/send/node_modules/debug/.npmignore
+++ b/node_modules/send/node_modules/debug/.npmignore
@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json
--- a/node_modules/send/node_modules/debug/.travis.yml
+++ b/node_modules/send/node_modules/debug/.travis.yml
@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+  - "6"
+  - "5"
+  - "4"
+
+install:
+  - make node_modules
+
+script:
+  - make lint
+  - make test
+  - make coveralls
--- a/node_modules/send/node_modules/debug/CHANGELOG.md
+++ b/node_modules/send/node_modules/debug/CHANGELOG.md
@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+  * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+  * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+  * Fix: Inline extend function in node implementation (#452, @dougwilson)
+  * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+  
+  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+  * Misc: clean up browser reference checks (#447, @thebigredgeek)
+  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+  * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+  * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+  * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+  * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+  * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+  * Docs: fixed README typo (#391, @lurch)
+  * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+  * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+  * Fix: wrong reference in bower file (@thebigredgeek)
+  * Fix: webworker compatibility (@thebigredgeek)
+  * Fix: output formatting issue (#388, @kribblo)
+  * Fix: babel-loader compatibility (#383, @escwald)
+  * Misc: removed built asset from repo and publications (@thebigredgeek)
+  * Misc: moved source files to /src (#378, @yamikuronue)
+  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+  * Test: coveralls integration (#378, @yamikuronue)
+  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+  * Fix: custom log function (#379, @hsiliev)
+  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+  * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+  * Fix: browser colors (#367, @tootallnate)
+  * Misc: travis ci integration (@thebigredgeek)
+  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+  * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+  * Fix: revert "handle regex special characters" (@tootallnate)
+  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+  * Improvement: allow colors in workers (#335, @botverse)
+  * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+  * Fix: be super-safe in index.js as well (@TooTallNate)
+  * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+  * Fix: Added electron compatibility (#324, @paulcbetts)
+  * Improvement: Added performance optimizations (@tootallnate)
+  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+  * Readme: fix USE_COLORS to DEBUG_COLORS
+  * Readme: Doc fixes for format string sugar (#269, @mlucool)
+  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+  * Readme: better docs for browser support (#224, @matthewmueller)
+  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+  * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release
--- a/node_modules/send/node_modules/debug/LICENSE
+++ b/node_modules/send/node_modules/debug/LICENSE
@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
+and associated documentation files (the 'Software'), to deal in the Software without restriction, 
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial 
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
--- a/node_modules/send/node_modules/debug/Makefile
+++ b/node_modules/send/node_modules/debug/Makefile
@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+	@NODE_ENV= $(PKG) install
+	@touch node_modules
+
+lint: .FORCE
+	eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+	istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+	mkdir -p dist
+
+	@$(BROWSERIFY) \
+		--standalone debug \
+		. > dist/debug.js
+
+	karma start --single-run
+	rimraf dist
+
+test: .FORCE
+	concurrently \
+		"make test-node" \
+		"make test-browser"
+
+coveralls:
+	cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean
--- a/node_modules/send/node_modules/debug/README.md
+++ b/node_modules/send/node_modules/debug/README.md
@ -0,0 +1,312 @@
+# debug
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) 
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+  debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+  ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+
+  ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+  ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+  When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+  ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+
+  When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+  ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
+
+## Conventions
+
+  If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+  The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+  You can also exclude specific debuggers by prefixing them with a "-" character.  For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+  When running through Node.js, you can set a few environment variables that will
+  change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+  __Note:__ The environment variables beginning with `DEBUG_` end up being
+  converted into an Options object that gets used with `%o`/`%O` formatters.
+  See the Node.js documentation for
+  [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+  for the complete list.
+
+## Formatters
+
+
+  Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+  You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+  You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+  or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+  if you don't want to build it yourself.
+
+  Debug's enable state is currently persisted by `localStorage`.
+  Consider the situation shown below where you have `worker:a` and `worker:b`,
+  and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+  Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+  option. These are WebKit web inspectors, Firefox ([since version
+  31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+  and the Firebug plugin for Firefox (any version).
+
+  Colored output looks something like:
+
+  ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
+
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+ 
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2016 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
--- a/node_modules/send/node_modules/debug/component.json
+++ b/node_modules/send/node_modules/debug/component.json
@ -0,0 +1,19 @@
+{
+  "name": "debug",
+  "repo": "visionmedia/debug",
+  "description": "small debugging utility",
+  "version": "2.6.9",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "main": "src/browser.js",
+  "scripts": [
+    "src/browser.js",
+    "src/debug.js"
+  ],
+  "dependencies": {
+    "rauchg/ms.js": "0.7.1"
+  }
+}
--- a/node_modules/send/node_modules/debug/karma.conf.js
+++ b/node_modules/send/node_modules/debug/karma.conf.js
@ -0,0 +1,70 @@
+// Karma configuration
+// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC)
+
+module.exports = function(config) {
+  config.set({
+
+    // base path that will be used to resolve all patterns (eg. files, exclude)
+    basePath: '',
+
+
+    // frameworks to use
+    // available frameworks: https://npmjs.org/browse/keyword/karma-adapter
+    frameworks: ['mocha', 'chai', 'sinon'],
+
+
+    // list of files / patterns to load in the browser
+    files: [
+      'dist/debug.js',
+      'test/*spec.js'
+    ],
+
+
+    // list of files to exclude
+    exclude: [
+      'src/node.js'
+    ],
+
+
+    // preprocess matching files before serving them to the browser
+    // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor
+    preprocessors: {
+    },
+
+    // test results reporter to use
+    // possible values: 'dots', 'progress'
+    // available reporters: https://npmjs.org/browse/keyword/karma-reporter
+    reporters: ['progress'],
+
+
+    // web server port
+    port: 9876,
+
+
+    // enable / disable colors in the output (reporters and logs)
+    colors: true,
+
+
+    // level of logging
+    // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG
+    logLevel: config.LOG_INFO,
+
+
+    // enable / disable watching file and executing tests whenever any file changes
+    autoWatch: true,
+
+
+    // start these browsers
+    // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher
+    browsers: ['PhantomJS'],
+
+
+    // Continuous Integration mode
+    // if true, Karma captures browsers, runs the tests and exits
+    singleRun: false,
+
+    // Concurrency level
+    // how many browser should be started simultaneous
+    concurrency: Infinity
+  })
+}
--- a/node_modules/send/node_modules/debug/node.js
+++ b/node_modules/send/node_modules/debug/node.js
@ -0,0 +1 @@
+module.exports = require('./src/node');
--- a/node_modules/send/node_modules/debug/package.json
+++ b/node_modules/send/node_modules/debug/package.json
@ -0,0 +1,49 @@
+{
+  "name": "debug",
+  "version": "2.6.9",
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/visionmedia/debug.git"
+  },
+  "description": "small debugging utility",
+  "keywords": [
+    "debug",
+    "log",
+    "debugger"
+  ],
+  "author": "TJ Holowaychuk <tj@vision-media.ca>",
+  "contributors": [
+    "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
+    "Andrew Rhyne <rhyneandrew@gmail.com>"
+  ],
+  "license": "MIT",
+  "dependencies": {
+    "ms": "2.0.0"
+  },
+  "devDependencies": {
+    "browserify": "9.0.3",
+    "chai": "^3.5.0",
+    "concurrently": "^3.1.0",
+    "coveralls": "^2.11.15",
+    "eslint": "^3.12.1",
+    "istanbul": "^0.4.5",
+    "karma": "^1.3.0",
+    "karma-chai": "^0.1.0",
+    "karma-mocha": "^1.3.0",
+    "karma-phantomjs-launcher": "^1.0.2",
+    "karma-sinon": "^1.0.5",
+    "mocha": "^3.2.0",
+    "mocha-lcov-reporter": "^1.2.0",
+    "rimraf": "^2.5.4",
+    "sinon": "^1.17.6",
+    "sinon-chai": "^2.8.0"
+  },
+  "main": "./src/index.js",
+  "browser": "./src/browser.js",
+  "component": {
+    "scripts": {
+      "debug/index.js": "browser.js",
+      "debug/debug.js": "debug.js"
+    }
+  }
+}
--- a/node_modules/send/node_modules/debug/src/browser.js
+++ b/node_modules/send/node_modules/debug/src/browser.js
@ -0,0 +1,185 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+               && 'undefined' != typeof chrome.storage
+                  ? chrome.storage.local
+                  : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+  'lightseagreen',
+  'forestgreen',
+  'goldenrod',
+  'dodgerblue',
+  'darkorchid',
+  'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+  // NB: In an Electron preload script, document will be defined but not fully
+  // initialized. Since we know we're in Chrome, we'll just detect this case
+  // explicitly
+  if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+    return true;
+  }
+
+  // is webkit? http://stackoverflow.com/a/16459606/376773
+  // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+  return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+    // is firebug? http://stackoverflow.com/a/398120/376773
+    (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+    // is firefox >= v31?
+    // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+    // double check webkit in userAgent just in case we are in a worker
+    (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+  try {
+    return JSON.stringify(v);
+  } catch (err) {
+    return '[UnexpectedJSONParseError]: ' + err.message;
+  }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var useColors = this.useColors;
+
+  args[0] = (useColors ? '%c' : '')
+    + this.namespace
+    + (useColors ? ' %c' : ' ')
+    + args[0]
+    + (useColors ? '%c ' : ' ')
+    + '+' + exports.humanize(this.diff);
+
+  if (!useColors) return;
+
+  var c = 'color: ' + this.color;
+  args.splice(1, 0, c, 'color: inherit')
+
+  // the final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-zA-Z%]/g, function(match) {
+    if ('%%' === match) return;
+    index++;
+    if ('%c' === match) {
+      // we only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+
+  args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+  // this hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return 'object' === typeof console
+    && console.log
+    && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  try {
+    if (null == namespaces) {
+      exports.storage.removeItem('debug');
+    } else {
+      exports.storage.debug = namespaces;
+    }
+  } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  var r;
+  try {
+    r = exports.storage.debug;
+  } catch(e) {}
+
+  // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+  if (!r && typeof process !== 'undefined' && 'env' in process) {
+    r = process.env.DEBUG;
+  }
+
+  return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+  try {
+    return window.localStorage;
+  } catch (e) {}
+}
--- a/node_modules/send/node_modules/debug/src/debug.js
+++ b/node_modules/send/node_modules/debug/src/debug.js
@ -0,0 +1,202 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+  var hash = 0, i;
+
+  for (i in namespace) {
+    hash  = ((hash << 5) - hash) + namespace.charCodeAt(i);
+    hash |= 0; // Convert to 32bit integer
+  }
+
+  return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+  function debug() {
+    // disabled?
+    if (!debug.enabled) return;
+
+    var self = debug;
+
+    // set `diff` timestamp
+    var curr = +new Date();
+    var ms = curr - (prevTime || curr);
+    self.diff = ms;
+    self.prev = prevTime;
+    self.curr = curr;
+    prevTime = curr;
+
+    // turn the `arguments` into a proper Array
+    var args = new Array(arguments.length);
+    for (var i = 0; i < args.length; i++) {
+      args[i] = arguments[i];
+    }
+
+    args[0] = exports.coerce(args[0]);
+
+    if ('string' !== typeof args[0]) {
+      // anything else let's inspect with %O
+      args.unshift('%O');
+    }
+
+    // apply any `formatters` transformations
+    var index = 0;
+    args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+      // if we encounter an escaped % then don't increase the array index
+      if (match === '%%') return match;
+      index++;
+      var formatter = exports.formatters[format];
+      if ('function' === typeof formatter) {
+        var val = args[index];
+        match = formatter.call(self, val);
+
+        // now we need to remove `args[index]` since it's inlined in the `format`
+        args.splice(index, 1);
+        index--;
+      }
+      return match;
+    });
+
+    // apply env-specific formatting (colors, etc.)
+    exports.formatArgs.call(self, args);
+
+    var logFn = debug.log || exports.log || console.log.bind(console);
+    logFn.apply(self, args);
+  }
+
+  debug.namespace = namespace;
+  debug.enabled = exports.enabled(namespace);
+  debug.useColors = exports.useColors();
+  debug.color = selectColor(namespace);
+
+  // env-specific initialization logic for debug instances
+  if ('function' === typeof exports.init) {
+    exports.init(debug);
+  }
+
+  return debug;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+  exports.save(namespaces);
+
+  exports.names = [];
+  exports.skips = [];
+
+  var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+  var len = split.length;
+
+  for (var i = 0; i < len; i++) {
+    if (!split[i]) continue; // ignore empty strings
+    namespaces = split[i].replace(/\*/g, '.*?');
+    if (namespaces[0] === '-') {
+      exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+    } else {
+      exports.names.push(new RegExp('^' + namespaces + '$'));
+    }
+  }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+  exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+  var i, len;
+  for (i = 0, len = exports.skips.length; i < len; i++) {
+    if (exports.skips[i].test(name)) {
+      return false;
+    }
+  }
+  for (i = 0, len = exports.names.length; i < len; i++) {
+    if (exports.names[i].test(name)) {
+      return true;
+    }
+  }
+  return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+  if (val instanceof Error) return val.stack || val.message;
+  return val;
+}
--- a/node_modules/send/node_modules/debug/src/index.js
+++ b/node_modules/send/node_modules/debug/src/index.js
@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process !== 'undefined' && process.type === 'renderer') {
+  module.exports = require('./browser.js');
+} else {
+  module.exports = require('./node.js');
+}
--- a/node_modules/send/node_modules/debug/src/inspector-log.js
+++ b/node_modules/send/node_modules/debug/src/inspector-log.js
@ -0,0 +1,15 @@
+module.exports = inspectorLog;
+
+// black hole
+const nullStream = new (require('stream').Writable)();
+nullStream._write = () => {};
+
+/**
+ * Outputs a `console.log()` to the Node.js Inspector console *only*.
+ */
+function inspectorLog() {
+  const stdout = console._stdout;
+  console._stdout = nullStream;
+  console.log.apply(console, arguments);
+  console._stdout = stdout;
+}
--- a/node_modules/send/node_modules/debug/src/node.js
+++ b/node_modules/send/node_modules/debug/src/node.js
@ -0,0 +1,248 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ *   $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+  return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+  // camel-case
+  var prop = key
+    .substring(6)
+    .toLowerCase()
+    .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+  // coerce string value into JS value
+  var val = process.env[key];
+  if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+  else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+  else if (val === 'null') val = null;
+  else val = Number(val);
+
+  obj[prop] = val;
+  return obj;
+}, {});
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ *   $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+
+if (1 !== fd && 2 !== fd) {
+  util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')()
+}
+
+var stream = 1 === fd ? process.stdout :
+             2 === fd ? process.stderr :
+             createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+  return 'colors' in exports.inspectOpts
+    ? Boolean(exports.inspectOpts.colors)
+    : tty.isatty(fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts)
+    .split('\n').map(function(str) {
+      return str.trim()
+    }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+  var name = this.namespace;
+  var useColors = this.useColors;
+
+  if (useColors) {
+    var c = this.color;
+    var prefix = '  \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m';
+
+    args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+    args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+  } else {
+    args[0] = new Date().toUTCString()
+      + ' ' + name + ' ' + args[0];
+  }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to `stream`.
+ */
+
+function log() {
+  return stream.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+  if (null == namespaces) {
+    // If you set a process.env field to null or undefined, it gets cast to the
+    // string 'null' or 'undefined'. Just delete instead.
+    delete process.env.DEBUG;
+  } else {
+    process.env.DEBUG = namespaces;
+  }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+  return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+  var stream;
+  var tty_wrap = process.binding('tty_wrap');
+
+  // Note stream._type is used for test-module-load-list.js
+
+  switch (tty_wrap.guessHandleType(fd)) {
+    case 'TTY':
+      stream = new tty.WriteStream(fd);
+      stream._type = 'tty';
+
+      // Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    case 'FILE':
+      var fs = require('fs');
+      stream = new fs.SyncWriteStream(fd, { autoClose: false });
+      stream._type = 'fs';
+      break;
+
+    case 'PIPE':
+    case 'TCP':
+      var net = require('net');
+      stream = new net.Socket({
+        fd: fd,
+        readable: false,
+        writable: true
+      });
+
+      // FIXME Should probably have an option in net.Socket to create a
+      // stream from an existing fd which is writable only. But for now
+      // we'll just add this hack and set the `readable` member to false.
+      // Test: ./node test/fixtures/echo.js < /etc/passwd
+      stream.readable = false;
+      stream.read = null;
+      stream._type = 'pipe';
+
+      // FIXME Hack to have stream not keep the event loop alive.
+      // See https://github.com/joyent/node/issues/1726
+      if (stream._handle && stream._handle.unref) {
+        stream._handle.unref();
+      }
+      break;
+
+    default:
+      // Probably an error on in uv_guess_handle()
+      throw new Error('Implement me. Unknown stream file type!');
+  }
+
+  // For supporting legacy API we put the FD here.
+  stream.fd = fd;
+
+  stream._isStdio = true;
+
+  return stream;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+  debug.inspectOpts = {};
+
+  var keys = Object.keys(exports.inspectOpts);
+  for (var i = 0; i < keys.length; i++) {
+    debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+  }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
--- a/node_modules/send/node_modules/statuses/HISTORY.md
+++ b/node_modules/send/node_modules/statuses/HISTORY.md
@ -0,0 +1,60 @@
+1.4.0 / 2017-10-20
+==================
+
+  * Add `STATUS_CODES` export
+
+1.3.1 / 2016-11-11
+==================
+
+  * Fix return type in JSDoc
+
+1.3.0 / 2016-05-17
+==================
+
+  * Add `421 Misdirected Request`
+  * perf: enable strict mode
+
+1.2.1 / 2015-02-01
+==================
+
+  * Fix message for status 451
+    - `451 Unavailable For Legal Reasons`
+
+1.2.0 / 2014-09-28
+==================
+
+  * Add `208 Already Repored`
+  * Add `226 IM Used`
+  * Add `306 (Unused)`
+  * Add `415 Unable For Legal Reasons`
+  * Add `508 Loop Detected`
+
+1.1.1 / 2014-09-24
+==================
+
+  * Add missing 308 to `codes.json`
+
+1.1.0 / 2014-09-21
+==================
+
+  * Add `codes.json` for universal support
+
+1.0.4 / 2014-08-20
+==================
+
+  * Package cleanup
+
+1.0.3 / 2014-06-08
+==================
+
+  * Add 308 to `.redirect` category
+
+1.0.2 / 2014-03-13
+==================
+
+  * Add `.retry` category
+
+1.0.1 / 2014-03-12
+==================
+
+  * Initial release
--- a/node_modules/send/node_modules/statuses/LICENSE
+++ b/node_modules/send/node_modules/statuses/LICENSE
@ -0,0 +1,23 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong <me@jongleberry.com>
+Copyright (c) 2016 Douglas Christopher Wilson <doug@somethingdoug.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
--- a/node_modules/send/node_modules/statuses/README.md
+++ b/node_modules/send/node_modules/statuses/README.md
@ -0,0 +1,127 @@
+# Statuses
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+HTTP status utility for node.
+
+This module provides a list of status codes and messages sourced from
+a few different projects:
+
+  * The [IANA Status Code Registry](https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml)
+  * The [Node.js project](https://nodejs.org/)
+  * The [NGINX project](https://www.nginx.com/)
+  * The [Apache HTTP Server project](https://httpd.apache.org/)
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install statuses
+```
+
+## API
+
+<!-- eslint-disable no-unused-vars -->
+
+```js
+var status = require('statuses')
+```
+
+### var code = status(Integer || String)
+
+If `Integer` or `String` is a valid HTTP code or status message, then the
+appropriate `code` will be returned. Otherwise, an error will be thrown.
+
+<!-- eslint-disable no-undef -->
+
+```js
+status(403) // => 403
+status('403') // => 403
+status('forbidden') // => 403
+status('Forbidden') // => 403
+status(306) // throws, as it's not supported by node.js
+```
+
+### status.STATUS_CODES
+
+Returns an object which maps status codes to status messages, in
+the same format as the
+[Node.js http module](https://nodejs.org/dist/latest/docs/api/http.html#http_http_status_codes).
+
+### status.codes
+
+Returns an array of all the status codes as `Integer`s.
+
+### var msg = status[code]
+
+Map of `code` to `status message`. `undefined` for invalid `code`s.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status[404] // => 'Not Found'
+```
+
+### var code = status[msg]
+
+Map of `status message` to `code`. `msg` can either be title-cased or
+lower-cased. `undefined` for invalid `status message`s.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status['not found'] // => 404
+status['Not Found'] // => 404
+```
+
+### status.redirect[code]
+
+Returns `true` if a status code is a valid redirect status.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status.redirect[200] // => undefined
+status.redirect[301] // => true
+```
+
+### status.empty[code]
+
+Returns `true` if a status code expects an empty body.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status.empty[200] // => undefined
+status.empty[204] // => true
+status.empty[304] // => true
+```
+
+### status.retry[code]
+
+Returns `true` if you should retry the rest.
+
+<!-- eslint-disable no-undef, no-unused-expressions -->
+
+```js
+status.retry[501] // => undefined
+status.retry[503] // => true
+```
+
+[npm-image]: https://img.shields.io/npm/v/statuses.svg
+[npm-url]: https://npmjs.org/package/statuses
+[node-version-image]: https://img.shields.io/node/v/statuses.svg
+[node-version-url]: https://nodejs.org/en/download
+[travis-image]: https://img.shields.io/travis/jshttp/statuses.svg
+[travis-url]: https://travis-ci.org/jshttp/statuses
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/statuses.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/statuses.svg
+[downloads-url]: https://npmjs.org/package/statuses
--- a/node_modules/send/node_modules/statuses/codes.json
+++ b/node_modules/send/node_modules/statuses/codes.json
@ -0,0 +1,65 @@
+{
+  "100": "Continue",
+  "101": "Switching Protocols",
+  "102": "Processing",
+  "200": "OK",
+  "201": "Created",
+  "202": "Accepted",
+  "203": "Non-Authoritative Information",
+  "204": "No Content",
+  "205": "Reset Content",
+  "206": "Partial Content",
+  "207": "Multi-Status",
+  "208": "Already Reported",
+  "226": "IM Used",
+  "300": "Multiple Choices",
+  "301": "Moved Permanently",
+  "302": "Found",
+  "303": "See Other",
+  "304": "Not Modified",
+  "305": "Use Proxy",
+  "306": "(Unused)",
+  "307": "Temporary Redirect",
+  "308": "Permanent Redirect",
+  "400": "Bad Request",
+  "401": "Unauthorized",
+  "402": "Payment Required",
+  "403": "Forbidden",
+  "404": "Not Found",
+  "405": "Method Not Allowed",
+  "406": "Not Acceptable",
+  "407": "Proxy Authentication Required",
+  "408": "Request Timeout",
+  "409": "Conflict",
+  "410": "Gone",
+  "411": "Length Required",
+  "412": "Precondition Failed",
+  "413": "Payload Too Large",
+  "414": "URI Too Long",
+  "415": "Unsupported Media Type",
+  "416": "Range Not Satisfiable",
+  "417": "Expectation Failed",
+  "418": "I'm a teapot",
+  "421": "Misdirected Request",
+  "422": "Unprocessable Entity",
+  "423": "Locked",
+  "424": "Failed Dependency",
+  "425": "Unordered Collection",
+  "426": "Upgrade Required",
+  "428": "Precondition Required",
+  "429": "Too Many Requests",
+  "431": "Request Header Fields Too Large",
+  "451": "Unavailable For Legal Reasons",
+  "500": "Internal Server Error",
+  "501": "Not Implemented",
+  "502": "Bad Gateway",
+  "503": "Service Unavailable",
+  "504": "Gateway Timeout",
+  "505": "HTTP Version Not Supported",
+  "506": "Variant Also Negotiates",
+  "507": "Insufficient Storage",
+  "508": "Loop Detected",
+  "509": "Bandwidth Limit Exceeded",
+  "510": "Not Extended",
+  "511": "Network Authentication Required"
+}
--- a/node_modules/send/node_modules/statuses/index.js
+++ b/node_modules/send/node_modules/statuses/index.js
@ -0,0 +1,113 @@
+/*!
+ * statuses
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var codes = require('./codes.json')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = status
+
+// status code to message map
+status.STATUS_CODES = codes
+
+// array of status codes
+status.codes = populateStatusesMap(status, codes)
+
+// status codes for redirects
+status.redirect = {
+  300: true,
+  301: true,
+  302: true,
+  303: true,
+  305: true,
+  307: true,
+  308: true
+}
+
+// status codes for empty bodies
+status.empty = {
+  204: true,
+  205: true,
+  304: true
+}
+
+// status codes for when you should retry the request
+status.retry = {
+  502: true,
+  503: true,
+  504: true
+}
+
+/**
+ * Populate the statuses map for given codes.
+ * @private
+ */
+
+function populateStatusesMap (statuses, codes) {
+  var arr = []
+
+  Object.keys(codes).forEach(function forEachCode (code) {
+    var message = codes[code]
+    var status = Number(code)
+
+    // Populate properties
+    statuses[status] = message
+    statuses[message] = status
+    statuses[message.toLowerCase()] = status
+
+    // Add to array
+    arr.push(status)
+  })
+
+  return arr
+}
+
+/**
+ * Get the status code.
+ *
+ * Given a number, this will throw if it is not a known status
+ * code, otherwise the code will be returned. Given a string,
+ * the string will be parsed for a number and return the code
+ * if valid, otherwise will lookup the code assuming this is
+ * the status message.
+ *
+ * @param {string|number} code
+ * @returns {number}
+ * @public
+ */
+
+function status (code) {
+  if (typeof code === 'number') {
+    if (!status[code]) throw new Error('invalid status code: ' + code)
+    return code
+  }
+
+  if (typeof code !== 'string') {
+    throw new TypeError('code must be a number or string')
+  }
+
+  // '403'
+  var n = parseInt(code, 10)
+  if (!isNaN(n)) {
+    if (!status[n]) throw new Error('invalid status code: ' + n)
+    return n
+  }
+
+  n = status[code.toLowerCase()]
+  if (!n) throw new Error('invalid status message: "' + code + '"')
+  return n
+}
--- a/node_modules/send/node_modules/statuses/package.json
+++ b/node_modules/send/node_modules/statuses/package.json
@ -0,0 +1,48 @@
+{
+  "name": "statuses",
+  "description": "HTTP status utility",
+  "version": "1.4.0",
+  "contributors": [
+    "Douglas Christopher Wilson <doug@somethingdoug.com>",
+    "Jonathan Ong <me@jongleberry.com> (http://jongleberry.com)"
+  ],
+  "repository": "jshttp/statuses",
+  "license": "MIT",
+  "keywords": [
+    "http",
+    "status",
+    "code"
+  ],
+  "files": [
+    "HISTORY.md",
+    "index.js",
+    "codes.json",
+    "LICENSE"
+  ],
+  "devDependencies": {
+    "csv-parse": "1.2.4",
+    "eslint": "3.19.0",
+    "eslint-config-standard": "10.2.1",
+    "eslint-plugin-import": "2.8.0",
+    "eslint-plugin-markdown": "1.0.0-beta.6",
+    "eslint-plugin-node": "5.2.0",
+    "eslint-plugin-promise": "3.6.0",
+    "eslint-plugin-standard": "3.0.1",
+    "istanbul": "0.4.5",
+    "mocha": "1.21.5",
+    "raw-body": "2.3.2",
+    "stream-to-array": "2.3.0"
+  },
+  "engines": {
+    "node": ">= 0.6"
+  },
+  "scripts": {
+    "build": "node scripts/build.js",
+    "fetch": "node scripts/fetch-apache.js && node scripts/fetch-iana.js && node scripts/fetch-nginx.js && node scripts/fetch-node.js",
+    "lint": "eslint --plugin markdown --ext js,md .",
+    "test": "mocha --reporter spec --check-leaks --bail test/",
+    "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+    "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+    "update": "npm run fetch && npm run build"
+  }
+}
--- a/node_modules/send/package.json
+++ b/node_modules/send/package.json
@ -0,0 +1,61 @@
+{
+  "name": "send",
+  "description": "Better streaming static file server with Range and conditional-GET support",
+  "version": "0.16.2",
+  "author": "TJ Holowaychuk <tj@vision-media.ca>",
+  "contributors": [
+    "Douglas Christopher Wilson <doug@somethingdoug.com>",
+    "James Wyatt Cready <jcready@gmail.com>",
+    "Jesús Leganés Combarro <piranna@gmail.com>"
+  ],
+  "license": "MIT",
+  "repository": "pillarjs/send",
+  "keywords": [
+    "static",
+    "file",
+    "server"
+  ],
+  "dependencies": {
+    "debug": "2.6.9",
+    "depd": "~1.1.2",
+    "destroy": "~1.0.4",
+    "encodeurl": "~1.0.2",
+    "escape-html": "~1.0.3",
+    "etag": "~1.8.1",
+    "fresh": "0.5.2",
+    "http-errors": "~1.6.2",
+    "mime": "1.4.1",
+    "ms": "2.0.0",
+    "on-finished": "~2.3.0",
+    "range-parser": "~1.2.0",
+    "statuses": "~1.4.0"
+  },
+  "devDependencies": {
+    "after": "0.8.2",
+    "eslint": "3.19.0",
+    "eslint-config-standard": "10.2.1",
+    "eslint-plugin-import": "2.8.0",
+    "eslint-plugin-markdown": "1.0.0-beta.6",
+    "eslint-plugin-node": "5.2.1",
+    "eslint-plugin-promise": "3.6.0",
+    "eslint-plugin-standard": "3.0.1",
+    "istanbul": "0.4.5",
+    "mocha": "2.5.3",
+    "supertest": "1.1.0"
+  },
+  "files": [
+    "HISTORY.md",
+    "LICENSE",
+    "README.md",
+    "index.js"
+  ],
+  "engines": {
+    "node": ">= 0.8.0"
+  },
+  "scripts": {
+    "lint": "eslint --plugin markdown --ext js,md .",
+    "test": "mocha --check-leaks --reporter spec --bail",
+    "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec",
+    "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot"
+  }
+}
				`@ -0,0 +1 @@`
				`repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve`